| Message |
|
|
|
wao nice solution ris........
|
|
|
|
we have tan60.tan.40.tan20.tan80
as we know that tan60=underroot 3
so the thing which we have to do is to prove tan40.tan20.tan80=tan60
sin40.sin20.sin80/cos40.cos20.cos80
(sin80/cos80)*[(cos20-cos60)/cos60+cos20]
sin80.cos20-cos60sin80/(cos60cos80+cos20cos80)
2cos20sin80-sin80/cos80+2cos20cos80
sin100+sin60-sin80/cos80+cos100+cos60 [sin100=sin80,cos100=-cos80]
so we get sin60/cos60 and hence tan60
now putting th evalue of tan40.tan20.tan80 in to the equation we shall get tan60.tan60=3 DONEEEEEEEEEEEEEEE!!!!!!!!!!!!!!!!!!!!!!!!
|
|
|
|
|
YA I KNOW THAT HOT BODY HAS HIGH TEMP BUT PLZ READ THE QUESTION
|
|
|
|
|
good question sir but u r a math teacher as we know plz tell the solution of this question.plz give some hints
|
|
|
|
|
ab=pq-qr-pr pq-r(p+q) [p+q=2r] pq-r*2r =pq-2r^2 [r=(p+q)/2]=pq-2*[(p+q)/2]^2=pq-1/2(p^2+q^2)-pq=-1/2(p^2+q^2)hence proved
|
|
|
|
|
th equation is x^2+x(q+p-2r)+pq-qr-pr let a and b be the roots of the equation a+b=2r-p-q as it is given that a=-b so 2r-p-q=0 so p+q=2r now for the product ab=pq-qr-pr
|
|
|
|
|
is it the answer plz post the answer if you know
|
|
|
|
|
what will be the remainder if (2239)^5 is divided by 229
|
|
|
|
|
same here akhil i also did work on it is (3976/497)*(4773/9546)*(594/9504)*(169364/10579) is it the answerplz reply
|
|
|
|
|
if a world kranti is written out in a dictionary then what will be the number of this world
|
|
|
|
|
i think the question is not valid electrons are emitted by photons whenever a light of suitable frequency falls on the cathode plate or on a metal the free electrons gains energy and get exicted. in hc verma an example is given that when we give water to flowers/plants you can compare it with that hope it works
|
|
|
|
|
Heat flows from hot body to a cold body is a spontaneous process. Hot body will lose energy in order to attain stability(keeping in mind that external force is zero)my qn is that the cold body is already stable then why will it gain energy bcoz everybody tends to have stability
|
|
|
|
|
IF HYDROGEN IS absorbed on the surface of metal like tungtson then the order of the reaction will be
(A) 0
(B) 1
(C) 2
(D) 3
|
|
|
|
|
|
if u v w are the non coplanar vectors then the equality[3u pv pw]-[pv w qv]-[2w qv qu]=0 holds for(A) exactly one value of (p,q)(B) exactly two value of (p,q)(C) more than two but not all the value of (p,q)(C) all the value of (p,q)
|
|
|
|
|
if u v w are non coplanar vectors and p, q are real numbers then the equallity [3u pv pw]
|
|
|
|
|
RATE ASSURED.........................A PAPERWEIGHT in the form of a hemisphere of radius 3.0 cm is used to hold down a printed page.An observer looks at the page vertically through the paperweight.At what weight above the page will the printed letters near the centre appear to the observer?
|
|
|
|
|
THE STUDENT COUNCIL is making snack bags for a class trip each snack bag will contain --1type of drink, 1 type of cookie, 1 type of fruit. To make each snack bag they will choose from 2type of drinks,4 type of cookie, and 2 type of fruit.HOW MANY COMBINATION of 1 type of drink, 1 type of cookie and 1 type of fruit are possible
|
|
|
|
|
thanx for the information
|
|
|
|
|
but as specified in the question can you elaborate it?He is not taking the same three children but can be one or two.
|
|
|
|
E-Store
