| Message |
|
|
|
Hey... thanks a lot Muskaan, i didn't realize it formed a part of the iodoform test....The explanaton of your answer can be seen in Madhusudan's answer...i'm not very good with naming...but after following his steps of the reaction i came to guess that crotonaldehyde is >>> CH3 - CH=CH - CHO
|
|
|
|
|
Why is paranitrophenol a very good acid, but paramethoxyphenol [ C6H4(OH)-4-OCH3 ] a very bad acid even though both have an oxygen?
|
|
|
|
Thanx a lot all of u ....the answer is indeed (c)
Does anyone have a link that has a summary of all the oxidising (and reducing) agents regarding what they oxidise and what they don't...
Also , if we use alk KMnO4 here...will we get
CH3C(triple bond)C - COOH
or something else?
|
|
|
|
CH3CH2CH3 + Br2 -----in light-----> gives CH3CH2CH2Br + HBr
This is because of free radical formation which takes place in presence of light.........
|
|
|
|
|
The answer is PHENOL because if C=O is attached to phenol, then it becomes sp3 hybridised, i.e. tetrahedral which makes resonance impossible (due to non-planar) structure....whereas phenol , i.e. the enol form has resonance stabilisation... So Albus, u were spot on, amit , cud u elaborate with an example??
|
|
|
|
|
The answer that i have written in my notes is 3,6-diketo heptanoyl chloride....so bakshay was closest.......but can someone explain how acyl/acid chlorides are named. Also, why is diketo used here instead of oxo or formyl?
|
|
|
|
|
Learn up all the reagents...don't try and mug up , like from a book like pradeep, thats what i did last year and ended up dropping, try and understand the mechanism, it helps in the boards too....
|
|
|
|
|
Its totally different from resonance, resonance is not a form of isomerism, the resonating forms , or the canonical forms are imaginary , whereas isomers of a compound are real
|
|
|
|
Metamerism is a form of positional isomerism (which is a form of structural isomerism)...
It is the shifting of a functional group within a compound:
for eg:
CH3CH2 - O - CH2CH3 .....&
CH3 - O - CH2CH2CH3
hope it helps...
|
|
|
|
|
i think it makes the solution aprotic
|
|
|
|
|
this time DCE cutoffs reached the sky abruptly...will they go even higher next year?
|
|
|
|
|
|
Naming : How to name CH3-C(=O)CH2-CH2-C(=O)CH2-C(=O)Cl
|
|
|
|
|
which is the only compound where enol form is more stable than the keto form....
|
|
|
|
|
when a body is rotating...its normal shifts to the end from the center , and so the torque due to the normal about the vertex becomes zero
|
|
|
|
Acidity can be decided by checking the stability of the respective anion formed...here OH minus for H20...RO- for alcohol C2H minus for C2H2...NH2 minus And R minus....now OH minus is stablilised by -I effect of O, so its best acid......alkenes , alkynes and alkanes always make bad acids ..just remember it...NH3 is a lewis base , so don't even count it and alkanes always come last on an acidity order:
actually alkynes > alkenes > alkanes in acidity...dunno the reason....but its true............NOW GIMME THE PROMISED RATES.....HEHE ...just kiddin...if u like it ... u may give....feel free ask for clarifications f u can't understand.
|
|
|
|
|
I am doing Ahluwalia/Ghosh ( bharati bhawan publications)... and its really brushing up my concepts...the only flaw is that it does not contain any solutions....but u can always consult your teachers or come to a forum like this one...DON'T BOTHER WITH PRADEEP ..SORRY TO SAY...I DID IT LAST YEAR...I HAD TO DROP AN YEAR...ITS TOO VAST AND DOESN'T HELP MUCH...FOR ORGANIC CONCEPTS DO P. BAHADUR or O.P TANDON
|
|
|
|
|
Give it a reading...do some ither topic for 5 mins, then come bak....write it down yourself....if can't remember...repeat process....also , u can write them all down on an A4 sheet and paste it on the wall in front of ur study....coz name reactions are almost always asked in the boards...
|
|
|
|
|
ALSO....the C-X bond is sp2 hybridised as opposed to sp3 in haloalkanes...so s character is more...so something happens...i don'r remember.....
|
|
|
|
|
LAH can reduce C=C bond only if conjugatin with double bond.......like in CH3-CH2=CH2-C(=O)-CH3........not relevant but i thought might as well share it with u.........
|
|
|
|
E-Store
