| Message |
|
|
|
It is number of sites available with ligand to coordinate with metalion
|
|
|
|
|
no single book is sufficient ,for practice u can choose arihant physical chem
|
|
|
|
|
RCOOAg +Br2 in presence of CCl4  RBr +AgBr +CO2
|
|
|
|
|
phenol reacts with CCl4 +alcoholic KOH to form salycylic acid ,when this reacts with CH3OH esterification takes place to form methyl salysylate called oil of winter green.
|
|
|
|
|
in presence of peroxide there is free radical addition reaction ouccrs so major is 1-bromopropane by intermediate free radical stability but in absence of peroxide ionic electrophilic addition so major is 2-bromopropane and minor 1-bromo product.
|
|
|
|
|
K2HgI4 +KOH is known as nessesler reagent use for test of zero group radical called NH3 or NH4 +.when reaction between both takes place form brown precipitate of millons base of iodideNH2-HgO-HgI.
|
|
|
|
|
hoffmanns martius and cope rearr is important.study it in detail
|
|
|
|
|
with Br2 first formation of cyclic halonium ion takes place than trans dihalo product formed across double bond.similar reaction with iodine.
|
|
|
|
|
alkenes reacts with con.H2SO4 is an example of addition of H2SO4.this is break down into H+ and -OSO3H so product is CH3-C(OSO3H)CH3-CH2CH2CH2CH3
|
|
|
|
|
c.alkenes reacts with cold KMnO4 so this oxidation reaction .in this reaction cis hydroxylation takes place.first cis addition of KMnO4 than hydrolysis with water to give 2-methyl hexane cis 1,2-diol. d.next reaction is halohydroxylation by hypochlorous acid.first formation of cyclic halonium ion than back attack of hydroxy anion takes place which give trans 1-chloro 2-methyl 2-hexanol.
|
|
|
|
|
a.this reaction is HBr in presence of peroxide so formation of free radical and free radical addition reaction takes place.ans is BrCH2-CH(CH3)-CH2CH2CH2CH3 b.this reaction is catalytic hydrogenation so product is 2-methyl hexane
|
|
|
|
|
this is 1,3 pentadiene which is conjugated diene shows resonance .if we add bromine at low temperature at 0 degree it form 1,2 -position addition while at high temperature at 40 -80 degree range it form 1,4 addition product as major.this is explain by competition between chemical kinetics and thermodynamical control reaction.normally at low temperature kinetically control product is major while at high temprature thermodynimacally product is major.
|
|
|
|
|
when SiCl4 undergo hydrolysis ,due to vacant orbital attack of nucleophile ouccrs so formation of Si(OH)4 takes place which finally converted to SiO2 KNOWN AS SILICA.IT IS HARD COVALENT COMPOUND WHERE ONE SILICON ATOM ATACH WITH FOUR OXYGEN SO IT IS sp3 hybridisation .bonding is similar like diamond.
|
|
|
|
|
ya above structure is right so all functional group are there.answer is d
|
|
|
|
