| Author |
Message |
![[Post New]](/templates/default/images/icon_minipost_new.gif) 22 Aug 2007 23:15:24 IST
|
|
|
prove that -:
tan 6 * tan 42 * tan 66 * tan78 =1
each angle is in degrees.
|
|
|
|
![[Post New]](/templates/default/images/icon_minipost_new.gif) 22 Aug 2007 23:29:19 IST
|
|
|
pairing tan66 and tan6
we have
tan66*tan6= (sin66sin6+cos66cos6)/cos66cos6-1=cos60/cos66cos6-1 =1/2cos66*cos6=1/(1/2+cos72)=4/(root5+1)-1
tan72*tan48=(sin72*sin48-cos48cos72)/cos48cos72 + 1 =1/cos120+cos36 +1 =4/(root5-1) +1
i guess multiplying it will give the desired result..
Please check
rate me if u feel like doing so ..
|
this reply: 0 points
(with 0 
in 0 votes ) [?]
|
|
You have to be logged on to rate
|
|
|
![[Post New]](/templates/default/images/icon_minipost_new.gif) 23 Aug 2007 14:01:11 IST
|
|
|

|
this reply: 0 points
(with 0 
in 0 votes ) [?]
|
|
You have to be logged on to rate
|
|
|
![[Post New]](/templates/default/images/icon_minipost_new.gif) 23 Aug 2007 18:10:37 IST
|
|
|
tan6.tan66 = (sin6.sin66)/(cos6.cos66) = (2sin6.sin66)/(2cos6.cos66)
Now apply 2cosA.cosB = cos(A+B) + cos(A-B) 2sinA.sinB = cos(A-B) - cos(A+B)
tan6.tan66 = (cos60 - cos72)/(cos60 + cos72)
= (1/2 - sin18)/(1/2 + sin18)
Now use sin18 = ( 5 - 1)/4
It will give tan6.tan66 = (3 - 5)/( 5 + 1)....................(1)
Now, tan42.tan78 = (2sin42.sin78)/(2cos42.cos78)
= (cos36 - cos120)/(cos36 + cos120)
Now use cos36 = ( 5 + 1)/4 and cos120 = -1/2
You will get tan42.tan78 = (3 + 5)/( 5 - 1)................(2)
From (1) and (2) :
tan6.tan42.tan66.tan78 = (3 - 5)(3 + 5) / ( 5 + 1)( 5 - 1)
= (9-5) / (5-1) = 1
|
Bipin Kumar Dubey
Chemical Dept.
IIT Kharagpur
|
this reply: 5 points
(with 1 
in 1 votes ) [?]
|
|
You have to be logged on to rate
|
|
|
|
|