|
|
|
|
|
| Author |
Message |
![[Post New]](/templates/default/images/icon_minipost_new.gif) 16 May 2008 16:22:35 IST
Accepted Answer [?]
![[Up]](/templates/default/images/icon_up.gif "[Up]")
|
|
|
Intra molecular aldol condensation takes place with wiht compounds with two CHO groups
Consider CHO-CH2-CH2-CH2-CH2-CH2-CHO
Addition of base will abstract one alpha H from the carbon atom next to one of the CHO groups.
So you get CHO-CH(-)-CH2-CH2-CH2-CH2-CHO
Now this carbanion is a nucleophile, while the carbonyl carbon of the other CHO group is an electrophile
So it attacks there leaving to a ring formation
Can't draw it her so I'll describe
6 membered ring with CHO and O(-) attached to adjacent carbon atoms. Now this O- abstracts H+ from whichever base had been used initially to give the aldol product, that is 2 Methly cyclohexanol
|
this reply: 10 points
(with 2 
in 2 votes ) [?]
|
|
You have to be logged on to rate
|
|
|
|
|
|
|
|
|
|
Moderation Team
